C26H33F3N4O6 — CID 146060159
3-[[N-(3-ethoxypropyl)-C-[4-(2-methoxyphenyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060159) has the molecular formula C26H33F3N4O6 and a molecular weight of 554.57 g/mol. Its IUPAC name is 3-[[N-(3-ethoxypropyl)-C-[4-(2-methoxyphenyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[N-(3-ethoxypropyl)-C-[4-(2-methoxyphenyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060159 |
| Molecular Formula | C26H33F3N4O6 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 3-[[N-(3-ethoxypropyl)-C-[4-(2-methoxyphenyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCOCCC/N=C(/Nc1cccc(C(=O)O)c1)N1CCN(c2ccccc2OC)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H32N4O4.C2HF3O2/c1-3-32-17-7-12-25-24(26-20-9-6-8-19(18-20)23(29)30)28-15-13-27(14-16-28)21-10-4-5-11-22(21)31-2;3-2(4,5)1(6)7/h4-6,8-11,18H,3,7,12-17H2,1-2H3,(H,25,26)(H,29,30);(H,6,7) |
| InChIKey | ZMSITSJISGHAJH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|