C23H34F3N5O6 — CID 146060266
3-[[N-(3-methoxypropyl)-C-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060266) has the molecular formula C23H34F3N5O6 and a molecular weight of 533.55 g/mol. Its IUPAC name is 3-[[N-(3-methoxypropyl)-C-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[N-(3-methoxypropyl)-C-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060266 |
| Molecular Formula | C23H34F3N5O6 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 3-[[N-(3-methoxypropyl)-C-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COCCC/N=C(/Nc1cccc(C(=O)O)c1)N1CCN(CC(=O)NC(C)C)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H33N5O4.C2HF3O2/c1-16(2)23-19(27)15-25-9-11-26(12-10-25)21(22-8-5-13-30-3)24-18-7-4-6-17(14-18)20(28)29;3-2(4,5)1(6)7/h4,6-7,14,16H,5,8-13,15H2,1-3H3,(H,22,24)(H,23,27)(H,28,29);(H,6,7) |
| InChIKey | UTDDNAUIVXKKJZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 143.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|