C23H30N4O4 — CID 46354165
3-[[C-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)carbonimidoyl]amino]benzoic acid (PubChem CID 46354165) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-[[C-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)carbonimidoyl]amino]benzoic acid.
| Compound Name | 3-[[C-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46354165 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-[[C-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(3-methoxypropyl)carbonimidoyl]amino]benzoic acid |
| SMILES | COCCC/N=C(/Nc1cccc(C(=O)O)c1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H30N4O4/c1-30-16-4-11-24-23(25-19-6-3-5-18(17-19)22(28)29)27-14-12-26(13-15-27)20-7-9-21(31-2)10-8-20/h3,5-10,17H,4,11-16H2,1-2H3,(H,24,25)(H,28,29) |
| InChIKey | GRIPNRFLRFSCNI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|