C23H29N3O4 — CID 9272112
tert-butyl N-[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]carbamate (PubChem CID 9272112) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]carbamate |
|---|---|
| PubChem CID | 9272112 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | tert-butyl N-[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]carbamate |
| SMILES | COc1ccc(N2CCN(C(=O)c3cccc(NC(=O)OC(C)(C)C)c3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-23(2,3)30-22(28)24-18-7-5-6-17(16-18)21(27)26-14-12-25(13-15-26)19-8-10-20(29-4)11-9-19/h5-11,16H,12-15H2,1-4H3,(H,24,28) |
| InChIKey | BWOKWWJOUSVHKG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|