C19H29N3O5S — CID 56534026
tert-butyl N-[3-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]phenyl]carbamate (PubChem CID 56534026) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]phenyl]carbamate |
|---|---|
| PubChem CID | 56534026 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | tert-butyl N-[3-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)N2CCN(CCS(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C19H29N3O5S/c1-19(2,3)27-18(24)20-16-7-5-6-15(14-16)17(23)22-10-8-21(9-11-22)12-13-28(4,25)26/h5-7,14H,8-13H2,1-4H3,(H,20,24) |
| InChIKey | PNGJYCISZWYMJJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |