C23H37N5O4 — CID 50800977
3-[[C-[4-[2-(tert-butylamino)-2-oxoethyl]piperazin-1-yl]-N-(3-ethoxypropyl)carbonimidoyl]amino]benzoic acid (PubChem CID 50800977) has the molecular formula C23H37N5O4 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-[[C-[4-[2-(tert-butylamino)-2-oxoethyl]piperazin-1-yl]-N-(3-ethoxypropyl)carbonimidoyl]amino]benzoic acid.
| Compound Name | 3-[[C-[4-[2-(tert-butylamino)-2-oxoethyl]piperazin-1-yl]-N-(3-ethoxypropyl)carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 50800977 |
| Molecular Formula | C23H37N5O4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 3-[[C-[4-[2-(tert-butylamino)-2-oxoethyl]piperazin-1-yl]-N-(3-ethoxypropyl)carbonimidoyl]amino]benzoic acid |
| SMILES | CCOCCC/N=C(/Nc1cccc(C(=O)O)c1)N1CCN(CC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H37N5O4/c1-5-32-15-7-10-24-22(25-19-9-6-8-18(16-19)21(30)31)28-13-11-27(12-14-28)17-20(29)26-23(2,3)4/h6,8-9,16H,5,7,10-15,17H2,1-4H3,(H,24,25)(H,26,29)(H,30,31) |
| InChIKey | JUJCNCZDJJOLKF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|