C26H30F6N4O5 — CID 146060043
4-[[N-(3-ethoxypropyl)-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060043) has the molecular formula C26H30F6N4O5 and a molecular weight of 592.54 g/mol. Its IUPAC name is 4-[[N-(3-ethoxypropyl)-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[N-(3-ethoxypropyl)-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060043 |
| Molecular Formula | C26H30F6N4O5 |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 4-[[N-(3-ethoxypropyl)-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCOCCC/N=C(/Nc1ccc(C(=O)O)cc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H29F3N4O3.C2HF3O2/c1-2-34-16-4-11-28-23(29-20-9-7-18(8-10-20)22(32)33)31-14-12-30(13-15-31)21-6-3-5-19(17-21)24(25,26)27;3-2(4,5)1(6)7/h3,5-10,17H,2,4,11-16H2,1H3,(H,28,29)(H,32,33);(H,6,7) |
| InChIKey | WZGRWPIEMSAEGL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|