C26H28N4O2 — CID 46347748
4-[[N-(2-phenylethyl)-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]benzoic acid (PubChem CID 46347748) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 4-[[N-(2-phenylethyl)-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]benzoic acid.
| Compound Name | 4-[[N-(2-phenylethyl)-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46347748 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 4-[[N-(2-phenylethyl)-C-(4-phenylpiperazin-1-yl)carbonimidoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N/C(=N/CCc2ccccc2)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H28N4O2/c31-25(32)22-11-13-23(14-12-22)28-26(27-16-15-21-7-3-1-4-8-21)30-19-17-29(18-20-30)24-9-5-2-6-10-24/h1-14H,15-20H2,(H,27,28)(H,31,32) |
| InChIKey | VBOMSOORGGRANA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|