C28H32N4O2 — CID 46354188
3-[[C-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid (PubChem CID 46354188) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[[C-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid.
| Compound Name | 3-[[C-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46354188 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 3-[[C-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid |
| SMILES | Cc1cccc(N2CCN(/C(=N\CCc3ccccc3)Nc3cccc(C(=O)O)c3)CC2)c1C |
| InChI | InChI=1S/C28H32N4O2/c1-21-8-6-13-26(22(21)2)31-16-18-32(19-17-31)28(29-15-14-23-9-4-3-5-10-23)30-25-12-7-11-24(20-25)27(33)34/h3-13,20H,14-19H2,1-2H3,(H,29,30)(H,33,34) |
| InChIKey | SLUCJVGRYICLST-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|