C26H36N4O2 — CID 92711527
4-[[C-[4-[(2R)-4-methylpentan-2-yl]piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid (PubChem CID 92711527) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-[[C-[4-[(2R)-4-methylpentan-2-yl]piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid.
| Compound Name | 4-[[C-[4-[(2R)-4-methylpentan-2-yl]piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 92711527 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 4-[[C-[4-[(2R)-4-methylpentan-2-yl]piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid |
| SMILES | CC(C)C[C@@H](C)N1CCN(/C(=N\CCc2ccccc2)Nc2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C26H36N4O2/c1-20(2)19-21(3)29-15-17-30(18-16-29)26(27-14-13-22-7-5-4-6-8-22)28-24-11-9-23(10-12-24)25(31)32/h4-12,20-21H,13-19H2,1-3H3,(H,27,28)(H,31,32)/t21-/m1/s1 |
| InChIKey | LTJSGCVOSBEOTE-OAQYLSRUSA-N |
| XLogP | 4.45 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|