C26H32ClF3N4O6 — CID 146060154
3-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-(3-methoxypropyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060154) has the molecular formula C26H32ClF3N4O6 and a molecular weight of 589.01 g/mol. Its IUPAC name is 3-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-(3-methoxypropyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-(3-methoxypropyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060154 |
| Molecular Formula | C26H32ClF3N4O6 |
| Molecular Weight | 589.01 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 3-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-(3-methoxypropyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COCCC/N=C(/Nc1cccc(C(=O)O)c1)N1CCN(CCOc2ccc(Cl)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H31ClN4O4.C2HF3O2/c1-32-16-3-10-26-24(27-21-5-2-4-19(18-21)23(30)31)29-13-11-28(12-14-29)15-17-33-22-8-6-20(25)7-9-22;3-2(4,5)1(6)7/h2,4-9,18H,3,10-17H2,1H3,(H,26,27)(H,30,31);(H,6,7) |
| InChIKey | SJEULLKSUGLWDM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.01 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|