C25H33N5O4 — CID 50801139
3-[[N-benzyl-C-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid (PubChem CID 50801139) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-[[N-benzyl-C-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid.
| Compound Name | 3-[[N-benzyl-C-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 50801139 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 3-[[N-benzyl-C-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid |
| SMILES | COCCCNC(=O)CN1CCN(/C(=N\Cc2ccccc2)Nc2cccc(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C25H33N5O4/c1-34-16-6-11-26-23(31)19-29-12-14-30(15-13-29)25(27-18-20-7-3-2-4-8-20)28-22-10-5-9-21(17-22)24(32)33/h2-5,7-10,17H,6,11-16,18-19H2,1H3,(H,26,31)(H,27,28)(H,32,33) |
| InChIKey | ABGWSOYTXQSNCA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|