C21H35IN6O3 — CID 111412119
2-[[N-benzyl-C-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111412119) has the molecular formula C21H35IN6O3 and a molecular weight of 546.45 g/mol. Its IUPAC name is 2-[[N-benzyl-C-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-benzyl-C-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111412119 |
| Molecular Formula | C21H35IN6O3 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 2-[[N-benzyl-C-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCCNC(=O)CN1CCN(/C(=N/Cc2ccccc2)NCC(=O)N(C)C)CC1.I |
| InChI | InChI=1S/C21H34N6O3.HI/c1-25(2)20(29)16-24-21(23-15-18-7-5-4-6-8-18)27-12-10-26(11-13-27)17-19(28)22-9-14-30-3;/h4-8H,9-17H2,1-3H3,(H,22,28)(H,23,24);1H |
| InChIKey | PWCBJQFQOLKYRQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|