C27H32ClF3N4O6 — CID 146060002
4-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060002) has the molecular formula C27H32ClF3N4O6 and a molecular weight of 601.02 g/mol. Its IUPAC name is 4-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060002 |
| Molecular Formula | C27H32ClF3N4O6 |
| Molecular Weight | 601.02 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 4-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1ccc(N/C(=N/CC2CCCO2)N2CCN(CCOc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H31ClN4O4.C2HF3O2/c26-20-5-9-22(10-6-20)34-17-15-29-11-13-30(14-12-29)25(27-18-23-2-1-16-33-23)28-21-7-3-19(4-8-21)24(31)32;3-2(4,5)1(6)7/h3-10,23H,1-2,11-18H2,(H,27,28)(H,31,32);(H,6,7) |
| InChIKey | ZIQGZYACKVUUMU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|