C23H23FN6O2 — CID 46347828
4-[[N-[(4-fluorophenyl)methyl]-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]benzoic acid (PubChem CID 46347828) has the molecular formula C23H23FN6O2 and a molecular weight of 434.48 g/mol. Its IUPAC name is 4-[[N-[(4-fluorophenyl)methyl]-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]benzoic acid.
| Compound Name | 4-[[N-[(4-fluorophenyl)methyl]-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46347828 |
| Molecular Formula | C23H23FN6O2 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 4-[[N-[(4-fluorophenyl)methyl]-C-(4-pyrimidin-2-ylpiperazin-1-yl)carbonimidoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N/C(=N/Cc2ccc(F)cc2)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C23H23FN6O2/c24-19-6-2-17(3-7-19)16-27-23(28-20-8-4-18(5-9-20)21(31)32)30-14-12-29(13-15-30)22-25-10-1-11-26-22/h1-11H,12-16H2,(H,27,28)(H,31,32) |
| InChIKey | OBBQCLOAMHDKTP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|