C26H26FN5 — CID 16719474
4-benzyl-N-(4-cyanophenyl)-N'-[(4-fluorophenyl)methyl]piperazine-1-carboximidamide (PubChem CID 16719474) has the molecular formula C26H26FN5 and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-benzyl-N-(4-cyanophenyl)-N'-[(4-fluorophenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N-(4-cyanophenyl)-N'-[(4-fluorophenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 16719474 |
| Molecular Formula | C26H26FN5 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 4-benzyl-N-(4-cyanophenyl)-N'-[(4-fluorophenyl)methyl]piperazine-1-carboximidamide |
| SMILES | N#Cc1ccc(N/C(=N/Cc2ccc(F)cc2)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H26FN5/c27-24-10-6-22(7-11-24)19-29-26(30-25-12-8-21(18-28)9-13-25)32-16-14-31(15-17-32)20-23-4-2-1-3-5-23/h1-13H,14-17,19-20H2,(H,29,30) |
| InChIKey | RAXCNRYVAMZHKE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|