C20H22N4OS — CID 8658135
4-[(4-cyanophenyl)methyl]-N-(4-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 8658135) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 4-[(4-cyanophenyl)methyl]-N-(4-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(4-cyanophenyl)methyl]-N-(4-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8658135 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-[(4-cyanophenyl)methyl]-N-(4-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCN(Cc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H22N4OS/c1-25-19-8-6-18(7-9-19)22-20(26)24-12-10-23(11-13-24)15-17-4-2-16(14-21)3-5-17/h2-9H,10-13,15H2,1H3,(H,22,26) |
| InChIKey | MGLKVBILVRRUID-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|