C24H28N4O3 — CID 55741236
butyl 4-[[4-[(4-cyanophenyl)methyl]piperazine-1-carbonyl]amino]benzoate (PubChem CID 55741236) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is butyl 4-[[4-[(4-cyanophenyl)methyl]piperazine-1-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[4-[(4-cyanophenyl)methyl]piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 55741236 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | butyl 4-[[4-[(4-cyanophenyl)methyl]piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)N2CCN(Cc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-2-3-16-31-23(29)21-8-10-22(11-9-21)26-24(30)28-14-12-27(13-15-28)18-20-6-4-19(17-25)5-7-20/h4-11H,2-3,12-16,18H2,1H3,(H,26,30) |
| InChIKey | MWNKWRWNKAIRCI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|