C19H19FIN3O2 — CID 27849909
N-(4-fluorophenyl)-2-[4-(3-iodobenzoyl)piperazin-1-yl]acetamide (PubChem CID 27849909) has the molecular formula C19H19FIN3O2 and a molecular weight of 467.28 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-(3-iodobenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-(3-iodobenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 27849909 |
| Molecular Formula | C19H19FIN3O2 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-(3-iodobenzoyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2cccc(I)c2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FIN3O2/c20-15-4-6-17(7-5-15)22-18(25)13-23-8-10-24(11-9-23)19(26)14-2-1-3-16(21)12-14/h1-7,12H,8-11,13H2,(H,22,25) |
| InChIKey | DXXVSHHELAOACM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|