C21H19F2N3O2S — CID 43017477
2-[4-(4-fluoro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 43017477) has the molecular formula C21H19F2N3O2S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[4-(4-fluoro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-(4-fluoro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 43017477 |
| Molecular Formula | C21H19F2N3O2S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-[4-(4-fluoro-1-benzothiophene-2-carbonyl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2cc3c(F)cccc3s2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H19F2N3O2S/c22-14-4-6-15(7-5-14)24-20(27)13-25-8-10-26(11-9-25)21(28)19-12-16-17(23)2-1-3-18(16)29-19/h1-7,12H,8-11,13H2,(H,24,27) |
| InChIKey | ULVAAWVMZYSPKM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |