C29H30F4N4O5 — CID 146060138
4-[[C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-[(3-methoxyphenyl)methyl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060138) has the molecular formula C29H30F4N4O5 and a molecular weight of 590.57 g/mol. Its IUPAC name is 4-[[C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-[(3-methoxyphenyl)methyl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-[(3-methoxyphenyl)methyl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060138 |
| Molecular Formula | C29H30F4N4O5 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 4-[[C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-[(3-methoxyphenyl)methyl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(C/N=C(/Nc2ccc(C(=O)O)cc2)N2CCN(Cc3ccccc3F)CC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H29FN4O3.C2HF3O2/c1-35-24-7-4-5-20(17-24)18-29-27(30-23-11-9-21(10-12-23)26(33)34)32-15-13-31(14-16-32)19-22-6-2-3-8-25(22)28;3-2(4,5)1(6)7/h2-12,17H,13-16,18-19H2,1H3,(H,29,30)(H,33,34);(H,6,7) |
| InChIKey | LGRKPFUMGVJPPZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|