C27H29FN4O3 — CID 46347890
4-[[C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-[(3-methoxyphenyl)methyl]carbonimidoyl]amino]benzoic acid (PubChem CID 46347890) has the molecular formula C27H29FN4O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is 4-[[C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-[(3-methoxyphenyl)methyl]carbonimidoyl]amino]benzoic acid.
| Compound Name | 4-[[C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-[(3-methoxyphenyl)methyl]carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46347890 |
| Molecular Formula | C27H29FN4O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 4-[[C-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-N-[(3-methoxyphenyl)methyl]carbonimidoyl]amino]benzoic acid |
| SMILES | COc1cccc(C/N=C(/Nc2ccc(C(=O)O)cc2)N2CCN(Cc3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C27H29FN4O3/c1-35-24-7-4-5-20(17-24)18-29-27(30-23-11-9-21(10-12-23)26(33)34)32-15-13-31(14-16-32)19-22-6-2-3-8-25(22)28/h2-12,17H,13-16,18-19H2,1H3,(H,29,30)(H,33,34) |
| InChIKey | CGLLVTGJFXCNAA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|