C14H21N4OS+ — CID 169364136
2-[4-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenoxy]ethyl-trimethylazanium (PubChem CID 169364136) has the molecular formula C14H21N4OS+ and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-[4-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenoxy]ethyl-trimethylazanium.
| Compound Name | 2-[4-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 169364136 |
| Molecular Formula | C14H21N4OS+ |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[4-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenoxy]ethyl-trimethylazanium |
| SMILES | CS/C(=N\c1ccc(OCC[N+](C)(C)C)cc1)NC#N |
| InChI | InChI=1S/C14H21N4OS/c1-18(2,3)9-10-19-13-7-5-12(6-8-13)17-14(20-4)16-11-15/h5-8H,9-10H2,1-4H3,(H,16,17)/q+1 |
| InChIKey | PMLOOQRKVVZDTN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|