C16H16N4OS — CID 169363297
methyl N-cyano-N'-[4-(2-pyridin-2-ylethoxy)phenyl]carbamimidothioate (PubChem CID 169363297) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-(2-pyridin-2-ylethoxy)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-(2-pyridin-2-ylethoxy)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169363297 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | methyl N-cyano-N'-[4-(2-pyridin-2-ylethoxy)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(OCCc2ccccn2)cc1)NC#N |
| InChI | InChI=1S/C16H16N4OS/c1-22-16(19-12-17)20-14-5-7-15(8-6-14)21-11-9-13-4-2-3-10-18-13/h2-8,10H,9,11H2,1H3,(H,19,20) |
| InChIKey | UXMGIZUDIOSJAR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|