C15H11N5OS — CID 169361343
methyl N-cyano-N'-(2-pyridin-2-yl-1,3-benzoxazol-5-yl)carbamimidothioate (PubChem CID 169361343) has the molecular formula C15H11N5OS and a molecular weight of 309.35 g/mol. Its IUPAC name is methyl N-cyano-N'-(2-pyridin-2-yl-1,3-benzoxazol-5-yl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(2-pyridin-2-yl-1,3-benzoxazol-5-yl)carbamimidothioate |
|---|---|
| PubChem CID | 169361343 |
| Molecular Formula | C15H11N5OS |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | methyl N-cyano-N'-(2-pyridin-2-yl-1,3-benzoxazol-5-yl)carbamimidothioate |
| SMILES | CS/C(=N\c1ccc2oc(-c3ccccn3)nc2c1)NC#N |
| InChI | InChI=1S/C15H11N5OS/c1-22-15(18-9-16)19-10-5-6-13-12(8-10)20-14(21-13)11-4-2-3-7-17-11/h2-8H,1H3,(H,18,19) |
| InChIKey | CJQZEHLOTCBCFY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|