C16H12N4OS — CID 169362573
methyl N-cyano-N'-(2-phenyl-1,3-benzoxazol-6-yl)carbamimidothioate (PubChem CID 169362573) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl N-cyano-N'-(2-phenyl-1,3-benzoxazol-6-yl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(2-phenyl-1,3-benzoxazol-6-yl)carbamimidothioate |
|---|---|
| PubChem CID | 169362573 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | methyl N-cyano-N'-(2-phenyl-1,3-benzoxazol-6-yl)carbamimidothioate |
| SMILES | CS/C(=N\c1ccc2nc(-c3ccccc3)oc2c1)NC#N |
| InChI | InChI=1S/C16H12N4OS/c1-22-16(18-10-17)19-12-7-8-13-14(9-12)21-15(20-13)11-5-3-2-4-6-11/h2-9H,1H3,(H,18,19) |
| InChIKey | UHINJZXRBPLWAH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|