C10H9N5S — CID 169360243
methyl N-cyano-N'-(1H-indazol-6-yl)carbamimidothioate (PubChem CID 169360243) has the molecular formula C10H9N5S and a molecular weight of 231.28 g/mol. Its IUPAC name is methyl N-cyano-N'-(1H-indazol-6-yl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(1H-indazol-6-yl)carbamimidothioate |
|---|---|
| PubChem CID | 169360243 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | methyl N-cyano-N'-(1H-indazol-6-yl)carbamimidothioate |
| SMILES | CS/C(=N\c1ccc2cn[nH]c2c1)NC#N |
| InChI | InChI=1S/C10H9N5S/c1-16-10(12-6-11)14-8-3-2-7-5-13-15-9(7)4-8/h2-5H,1H3,(H,12,14)(H,13,15) |
| InChIKey | AKPXGRZUUDVHSB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|