C9H8F5N3S2 — CID 90070799
methyl N-cyano-N'-[3-(pentafluoro-λ6-sulfanyl)phenyl]carbamimidothioate (PubChem CID 90070799) has the molecular formula C9H8F5N3S2 and a molecular weight of 317.31 g/mol. Its IUPAC name is methyl N-cyano-N'-[3-(pentafluoro-λ6-sulfanyl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[3-(pentafluoro-λ6-sulfanyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 90070799 |
| Molecular Formula | C9H8F5N3S2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | methyl N-cyano-N'-[3-(pentafluoro-λ6-sulfanyl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cccc(S(F)(F)(F)(F)F)c1)NC#N |
| InChI | InChI=1S/C9H8F5N3S2/c1-18-9(16-6-15)17-7-3-2-4-8(5-7)19(10,11,12,13)14/h2-5H,1H3,(H,16,17) |
| InChIKey | KWIOZTVYRLGNAZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|