C17H14N4OS — CID 169361155
methyl N-cyano-N'-[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]carbamimidothioate (PubChem CID 169361155) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is methyl N-cyano-N'-[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]carbamimidothioate |
|---|---|
| PubChem CID | 169361155 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | methyl N-cyano-N'-[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc2nc(-c3ccc(C)cc3)oc2c1)NC#N |
| InChI | InChI=1S/C17H14N4OS/c1-11-3-5-12(6-4-11)16-21-14-8-7-13(9-15(14)22-16)20-17(23-2)19-10-18/h3-9H,1-2H3,(H,19,20) |
| InChIKey | UASJWJMIINYFPA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|