C20H20N4OS — CID 169362366
methyl N'-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-N-cyanocarbamimidothioate (PubChem CID 169362366) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is methyl N'-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169362366 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl N'-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(/N=C(/NC#N)SC)cc3)nc2c1 |
| InChI | InChI=1S/C20H20N4OS/c1-4-13(2)15-7-10-18-17(11-15)24-19(25-18)14-5-8-16(9-6-14)23-20(26-3)22-12-21/h5-11,13H,4H2,1-3H3,(H,22,23) |
| InChIKey | IOGVBGDFHNLKKV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|