C17H11N5O — CID 169338360
2-[[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]hydrazinylidene]propanedinitrile (PubChem CID 169338360) has the molecular formula C17H11N5O and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-[[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169338360 |
| Molecular Formula | C17H11N5O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[[2-(4-methylphenyl)-1,3-benzoxazol-6-yl]hydrazinylidene]propanedinitrile |
| SMILES | Cc1ccc(-c2nc3ccc(NN=C(C#N)C#N)cc3o2)cc1 |
| InChI | InChI=1S/C17H11N5O/c1-11-2-4-12(5-3-11)17-20-15-7-6-13(8-16(15)23-17)21-22-14(9-18)10-19/h2-8,21H,1H3 |
| InChIKey | DJYXTDAZCFUZQC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|