C17H10N4O — CID 56696672
2-[[(2-phenyl-1,3-benzoxazol-6-yl)amino]methylidene]propanedinitrile (PubChem CID 56696672) has the molecular formula C17H10N4O and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-[[(2-phenyl-1,3-benzoxazol-6-yl)amino]methylidene]propanedinitrile.
| Compound Name | 2-[[(2-phenyl-1,3-benzoxazol-6-yl)amino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 56696672 |
| Molecular Formula | C17H10N4O |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[[(2-phenyl-1,3-benzoxazol-6-yl)amino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc2nc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C17H10N4O/c18-9-12(10-19)11-20-14-6-7-15-16(8-14)22-17(21-15)13-4-2-1-3-5-13/h1-8,11,20H |
| InChIKey | XKZUOQMVHWORTH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 85.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|