About methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate
methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate (PubChem CID 169363016) has the molecular formula C13H12N4OS
and a molecular weight of 272.33 g/mol. Its IUPAC name is methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate.
Molecular Properties
| Compound Name | methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate |
| PubChem CID | 169363016 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate |
| SMILES | COc1ccc2cc(/N=C(/NC#N)SC)ccc2n1 |
| InChI | InChI=1S/C13H12N4OS/c1-18-12-6-3-9-7-10(4-5-11(9)17-12)16-13(19-2)15-8-14/h3-7H,1-2H3,(H,15,16) |
| InChIKey | GPNVUWXNUPMTEE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate?
The IUPAC name of methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate (CID 169363016) is methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate.
What is the SMILES notation for methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate?
The canonical SMILES for methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate is COc1ccc2cc(/N=C(/NC#N)SC)ccc2n1.
What is the InChIKey of methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate?
The InChIKey is GPNVUWXNUPMTEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4OS/c1-18-12-6-3-9-7-10(4-5-11(9)17-12)16-13(19-2)15-8-14/h3-7H,1-2H3,(H,15,16).
What are the key properties of methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate?
methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate has a molecular weight of 272.33 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-cyano-N'-(2-methoxyquinolin-6-yl)carbamimidothioate is sourced from PubChem (CID 169363016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).