C16H13ClN6OS — CID 169362358
methyl N'-[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]-N-cyanocarbamimidothioate (PubChem CID 169362358) has the molecular formula C16H13ClN6OS and a molecular weight of 372.84 g/mol. Its IUPAC name is methyl N'-[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169362358 |
| Molecular Formula | C16H13ClN6OS |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | methyl N'-[2-(3-chloro-4-methoxyphenyl)benzotriazol-5-yl]-N-cyanocarbamimidothioate |
| SMILES | COc1ccc(-n2nc3ccc(/N=C(/NC#N)SC)cc3n2)cc1Cl |
| InChI | InChI=1S/C16H13ClN6OS/c1-24-15-6-4-11(8-12(15)17)23-21-13-5-3-10(7-14(13)22-23)20-16(25-2)19-9-18/h3-8H,1-2H3,(H,19,20) |
| InChIKey | DMMFAQMRFXDYFU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|