C12H9Cl2N5S — CID 169364799
methyl N-cyano-N'-[4-(4,5-dichloroimidazol-1-yl)phenyl]carbamimidothioate (PubChem CID 169364799) has the molecular formula C12H9Cl2N5S and a molecular weight of 326.21 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-(4,5-dichloroimidazol-1-yl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-(4,5-dichloroimidazol-1-yl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169364799 |
| Molecular Formula | C12H9Cl2N5S |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | methyl N-cyano-N'-[4-(4,5-dichloroimidazol-1-yl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(-n2cnc(Cl)c2Cl)cc1)NC#N |
| InChI | InChI=1S/C12H9Cl2N5S/c1-20-12(16-6-15)18-8-2-4-9(5-3-8)19-7-17-10(13)11(19)14/h2-5,7H,1H3,(H,16,18) |
| InChIKey | RBSCDOLCKVTKIA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|