C11H10N4O2S — CID 66656852
4-(methylideneamino)-N-pyrimidin-2-ylbenzenesulfonamide (PubChem CID 66656852) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is 4-(methylideneamino)-N-pyrimidin-2-ylbenzenesulfonamide.
| Compound Name | 4-(methylideneamino)-N-pyrimidin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 66656852 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 4-(methylideneamino)-N-pyrimidin-2-ylbenzenesulfonamide |
| SMILES | C=Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C11H10N4O2S/c1-12-9-3-5-10(6-4-9)18(16,17)15-11-13-7-2-8-14-11/h2-8H,1H2,(H,13,14,15) |
| InChIKey | ANFNYXOXBIDOFE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|