C15H16ClN3O3S — CID 169366539
2-chloro-N'-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethanimidamide (PubChem CID 169366539) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 2-chloro-N'-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366539 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-chloro-N'-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethanimidamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(/N=C(/N)CCl)cc2)cc1 |
| InChI | InChI=1S/C15H16ClN3O3S/c1-22-13-6-2-12(3-7-13)19-23(20,21)14-8-4-11(5-9-14)18-15(17)10-16/h2-9,19H,10H2,1H3,(H2,17,18) |
| InChIKey | ZTCBLSIZZHCYRK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|