C17H20N2O6S — CID 4618200
N-(2-hydroxyethyl)-2-[4-[(4-methoxyphenyl)sulfamoyl]phenoxy]acetamide (PubChem CID 4618200) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[4-[(4-methoxyphenyl)sulfamoyl]phenoxy]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[4-[(4-methoxyphenyl)sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4618200 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[4-[(4-methoxyphenyl)sulfamoyl]phenoxy]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(OCC(=O)NCCO)cc2)cc1 |
| InChI | InChI=1S/C17H20N2O6S/c1-24-14-4-2-13(3-5-14)19-26(22,23)16-8-6-15(7-9-16)25-12-17(21)18-10-11-20/h2-9,19-20H,10-12H2,1H3,(H,18,21) |
| InChIKey | SVBMJLOEQVMIEK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |