C17H20N2O5S — CID 3971824
N-(2-hydroxyethyl)-2-[4-[(2-methylphenyl)sulfamoyl]phenoxy]acetamide (PubChem CID 3971824) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[4-[(2-methylphenyl)sulfamoyl]phenoxy]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[4-[(2-methylphenyl)sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 3971824 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[4-[(2-methylphenyl)sulfamoyl]phenoxy]acetamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(OCC(=O)NCCO)cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-13-4-2-3-5-16(13)19-25(22,23)15-8-6-14(7-9-15)24-12-17(21)18-10-11-20/h2-9,19-20H,10-12H2,1H3,(H,18,21) |
| InChIKey | LHHULEJMIFSHCX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |