C21H13ClN2O6S — CID 11561582
4-[(7-chloro-9,10-dioxoanthracen-2-yl)sulfonylamino]-N-hydroxybenzamide (PubChem CID 11561582) has the molecular formula C21H13ClN2O6S and a molecular weight of 456.86 g/mol. Its IUPAC name is 4-[(7-chloro-9,10-dioxoanthracen-2-yl)sulfonylamino]-N-hydroxybenzamide.
| Compound Name | 4-[(7-chloro-9,10-dioxoanthracen-2-yl)sulfonylamino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 11561582 |
| Molecular Formula | C21H13ClN2O6S |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 4-[(7-chloro-9,10-dioxoanthracen-2-yl)sulfonylamino]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(NS(=O)(=O)c2ccc3c(c2)C(=O)c2cc(Cl)ccc2C3=O)cc1 |
| InChI | InChI=1S/C21H13ClN2O6S/c22-12-3-7-15-17(9-12)20(26)18-10-14(6-8-16(18)19(15)25)31(29,30)24-13-4-1-11(2-5-13)21(27)23-28/h1-10,24,28H,(H,23,27) |
| InChIKey | OHBFTIWUVMHFNR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|