C15H17N3O4S — CID 17192611
3-[(4-methoxyphenyl)sulfonylamino]-N-pyridin-4-ylpropanamide (PubChem CID 17192611) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)sulfonylamino]-N-pyridin-4-ylpropanamide.
| Compound Name | 3-[(4-methoxyphenyl)sulfonylamino]-N-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 17192611 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-[(4-methoxyphenyl)sulfonylamino]-N-pyridin-4-ylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C15H17N3O4S/c1-22-13-2-4-14(5-3-13)23(20,21)17-11-8-15(19)18-12-6-9-16-10-7-12/h2-7,9-10,17H,8,11H2,1H3,(H,16,18,19) |
| InChIKey | XQCITRCJYPUNKG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |