C24H27N3O6S2 — CID 17192752
N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-[(4-methoxyphenyl)sulfonylamino]propanamide (PubChem CID 17192752) has the molecular formula C24H27N3O6S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-[(4-methoxyphenyl)sulfonylamino]propanamide.
| Compound Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-[(4-methoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 17192752 |
| Molecular Formula | C24H27N3O6S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-3-[(4-methoxyphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(=O)Nc2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O6S2/c1-27(18-19-6-4-3-5-7-19)35(31,32)23-12-8-20(9-13-23)26-24(28)16-17-25-34(29,30)22-14-10-21(33-2)11-15-22/h3-15,25H,16-18H2,1-2H3,(H,26,28) |
| InChIKey | LAXUOXIWEJWKRD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |