C25H30N2O4S — CID 54475014
8-(naphthalen-2-ylsulfonylamino)-5-(2-pyridin-3-ylethyl)octanoic acid (PubChem CID 54475014) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is 8-(naphthalen-2-ylsulfonylamino)-5-(2-pyridin-3-ylethyl)octanoic acid.
| Compound Name | 8-(naphthalen-2-ylsulfonylamino)-5-(2-pyridin-3-ylethyl)octanoic acid |
|---|---|
| PubChem CID | 54475014 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 8-(naphthalen-2-ylsulfonylamino)-5-(2-pyridin-3-ylethyl)octanoic acid |
| SMILES | O=C(O)CCCC(CCCNS(=O)(=O)c1ccc2ccccc2c1)CCc1cccnc1 |
| InChI | InChI=1S/C25H30N2O4S/c28-25(29)11-3-6-20(12-13-21-8-4-16-26-19-21)7-5-17-27-32(30,31)24-15-14-22-9-1-2-10-23(22)18-24/h1-2,4,8-10,14-16,18-20,27H,3,5-7,11-13,17H2,(H,28,29) |
| InChIKey | XKYJSPTUSXHKME-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|