C24H31N3O4S — CID 19874767
4-(3-imidazol-1-ylpropyl)-8-(naphthalen-2-ylsulfonylamino)octanoic acid (PubChem CID 19874767) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 4-(3-imidazol-1-ylpropyl)-8-(naphthalen-2-ylsulfonylamino)octanoic acid.
| Compound Name | 4-(3-imidazol-1-ylpropyl)-8-(naphthalen-2-ylsulfonylamino)octanoic acid |
|---|---|
| PubChem CID | 19874767 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-(3-imidazol-1-ylpropyl)-8-(naphthalen-2-ylsulfonylamino)octanoic acid |
| SMILES | O=C(O)CCC(CCCCNS(=O)(=O)c1ccc2ccccc2c1)CCCn1ccnc1 |
| InChI | InChI=1S/C24H31N3O4S/c28-24(29)13-10-20(7-5-16-27-17-15-25-19-27)6-3-4-14-26-32(30,31)23-12-11-21-8-1-2-9-22(21)18-23/h1-2,8-9,11-12,15,17-20,26H,3-7,10,13-14,16H2,(H,28,29) |
| InChIKey | ZUWYMEVDZGEPEG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|