C23H24N2O7S — CID 18532985
4-hydroxy-2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-5-pyridin-3-yloxypentanoic acid (PubChem CID 18532985) has the molecular formula C23H24N2O7S and a molecular weight of 472.52 g/mol. Its IUPAC name is 4-hydroxy-2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-5-pyridin-3-yloxypentanoic acid.
| Compound Name | 4-hydroxy-2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-5-pyridin-3-yloxypentanoic acid |
|---|---|
| PubChem CID | 18532985 |
| Molecular Formula | C23H24N2O7S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 4-hydroxy-2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-5-pyridin-3-yloxypentanoic acid |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)NC(CC(O)COc3cccnc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O7S/c1-31-19-8-4-16(5-9-19)17-6-10-21(11-7-17)33(29,30)25-22(23(27)28)13-18(26)15-32-20-3-2-12-24-14-20/h2-12,14,18,22,25-26H,13,15H2,1H3,(H,27,28) |
| InChIKey | HGZMNDLJOZNBCM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |