C24H28ClN3O4S — CID 139688596
3-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-imidazol-1-ylhexan-2-yl]phenyl]propanoic acid (PubChem CID 139688596) has the molecular formula C24H28ClN3O4S and a molecular weight of 490.03 g/mol. Its IUPAC name is 3-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-imidazol-1-ylhexan-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-imidazol-1-ylhexan-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139688596 |
| Molecular Formula | C24H28ClN3O4S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 3-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-imidazol-1-ylhexan-2-yl]phenyl]propanoic acid |
| SMILES | CC(CCC(CNS(=O)(=O)c1ccc(Cl)cc1)c1ccc(CCC(=O)O)cc1)n1ccnc1 |
| InChI | InChI=1S/C24H28ClN3O4S/c1-18(28-15-14-26-17-28)2-6-21(20-7-3-19(4-8-20)5-13-24(29)30)16-27-33(31,32)23-11-9-22(25)10-12-23/h3-4,7-12,14-15,17-18,21,27H,2,5-6,13,16H2,1H3,(H,29,30) |
| InChIKey | ZVIJEVMWLOZPOH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |