C23H26ClN3O5S — CID 139688587
2-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-imidazol-1-ylhexan-2-yl]phenoxy]acetic acid (PubChem CID 139688587) has the molecular formula C23H26ClN3O5S and a molecular weight of 492.00 g/mol. Its IUPAC name is 2-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-imidazol-1-ylhexan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-imidazol-1-ylhexan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 139688587 |
| Molecular Formula | C23H26ClN3O5S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-imidazol-1-ylhexan-2-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C(CCCCn2ccnc2)CNS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H26ClN3O5S/c24-20-6-10-22(11-7-20)33(30,31)26-15-19(3-1-2-13-27-14-12-25-17-27)18-4-8-21(9-5-18)32-16-23(28)29/h4-12,14,17,19,26H,1-3,13,15-16H2,(H,28,29) |
| InChIKey | MHPFQWLPJVOCAZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|