C16H24Cl3N3O2 — CID 70213779
1-[2-(4-chlorophenoxy)ethylamino]-5-imidazol-1-ylpentan-1-ol;dihydrochloride (PubChem CID 70213779) has the molecular formula C16H24Cl3N3O2 and a molecular weight of 396.75 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethylamino]-5-imidazol-1-ylpentan-1-ol;dihydrochloride.
| Compound Name | 1-[2-(4-chlorophenoxy)ethylamino]-5-imidazol-1-ylpentan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 70213779 |
| Molecular Formula | C16H24Cl3N3O2 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethylamino]-5-imidazol-1-ylpentan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.OC(CCCCn1ccnc1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClN3O2.2ClH/c17-14-4-6-15(7-5-14)22-12-9-19-16(21)3-1-2-10-20-11-8-18-13-20;;/h4-8,11,13,16,19,21H,1-3,9-10,12H2;2*1H |
| InChIKey | HBOKFUCMSUSVAF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|