C23H20ClN3O2S — CID 10173558
4-(4-chlorophenyl)-N-(2-imidazol-1-yl-2-phenylethyl)benzenesulfonamide (PubChem CID 10173558) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(2-imidazol-1-yl-2-phenylethyl)benzenesulfonamide.
| Compound Name | 4-(4-chlorophenyl)-N-(2-imidazol-1-yl-2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 10173558 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(2-imidazol-1-yl-2-phenylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1ccccc1)n1ccnc1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H20ClN3O2S/c24-21-10-6-18(7-11-21)19-8-12-22(13-9-19)30(28,29)26-16-23(27-15-14-25-17-27)20-4-2-1-3-5-20/h1-15,17,23,26H,16H2 |
| InChIKey | QVMVWXVZAMSOQJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |