C22H19ClN4O2S — CID 992047
4-chloro-N-[(2R)-2-phenyl-2-(4-phenyltriazol-1-yl)ethyl]benzenesulfonamide (PubChem CID 992047) has the molecular formula C22H19ClN4O2S and a molecular weight of 438.94 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-2-phenyl-2-(4-phenyltriazol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2R)-2-phenyl-2-(4-phenyltriazol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 992047 |
| Molecular Formula | C22H19ClN4O2S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 4-chloro-N-[(2R)-2-phenyl-2-(4-phenyltriazol-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@@H](c1ccccc1)n1cc(-c2ccccc2)nn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClN4O2S/c23-19-11-13-20(14-12-19)30(28,29)24-15-22(18-9-5-2-6-10-18)27-16-21(25-26-27)17-7-3-1-4-8-17/h1-14,16,22,24H,15H2/t22-/m0/s1 |
| InChIKey | UBRQZWHHLVSYLB-QFIPXVFZSA-N |
| XLogP | 4.17 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |